About 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide
2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide (PubChem CID 56672720) has the molecular formula C19H31N3O3
and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide |
| PubChem CID | 56672720 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide |
| SMILES | COCCN(/C(=N\O)c1cccnc1OCC1CCCCC1)C(C)C |
| InChI | InChI=1S/C19H31N3O3/c1-15(2)22(12-13-24-3)18(21-23)17-10-7-11-20-19(17)25-14-16-8-5-4-6-9-16/h7,10-11,15-16,23H,4-6,8-9,12-14H2,1-3H3/b21-18- |
| InChIKey | DAQGYPVOVCFWLA-UZYVYHOESA-N |
| XLogP | 3.53 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide?
The IUPAC name of 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide (CID 56672720) is 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide.
What is the SMILES notation for 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide?
The canonical SMILES for 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide is COCCN(/C(=N\O)c1cccnc1OCC1CCCCC1)C(C)C.
What is the InChIKey of 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide?
The InChIKey is DAQGYPVOVCFWLA-UZYVYHOESA-N. The full InChI is InChI=1S/C19H31N3O3/c1-15(2)22(12-13-24-3)18(21-23)17-10-7-11-20-19(17)25-14-16-8-5-4-6-9-16/h7,10-11,15-16,23H,4-6,8-9,12-14H2,1-3H3/b21-18-.
What are the key properties of 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide?
2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide has a molecular weight of 349.48 g/mol, XLogP of 3.53, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylmethoxy)-N'-hydroxy-N-(2-methoxyethyl)-N-propan-2-ylpyridine-3-carboximidamide is sourced from PubChem (CID 56672720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).