About (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol
(1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol (PubChem CID 56673170) has the molecular formula C11H16O5S
and a molecular weight of 260.31 g/mol. Its IUPAC name is (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol.
Molecular Properties
| Compound Name | (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol |
| PubChem CID | 56673170 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol |
| SMILES | COC[C@H](O)[C@H](O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H16O5S/c1-16-7-10(12)11(13)8-3-5-9(6-4-8)17(2,14)15/h3-6,10-13H,7H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | OMFXADSYEFJJKD-WDEREUQCSA-N |
| XLogP | 0.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol?
The IUPAC name of (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol (CID 56673170) is (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol.
What is the SMILES notation for (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol?
The canonical SMILES for (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol is COC[C@H](O)[C@H](O)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol?
The InChIKey is OMFXADSYEFJJKD-WDEREUQCSA-N. The full InChI is InChI=1S/C11H16O5S/c1-16-7-10(12)11(13)8-3-5-9(6-4-8)17(2,14)15/h3-6,10-13H,7H2,1-2H3/t10-,11+/m0/s1.
What are the key properties of (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol?
(1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol has a molecular weight of 260.31 g/mol, XLogP of 0.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-3-methoxy-1-(4-methylsulfonylphenyl)propane-1,2-diol is sourced from PubChem (CID 56673170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).