C17H18Cl5N5 — CID 566732
4-(3,4-dichlorophenyl)-N-[(1-methylpiperidin-2-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 566732) has the molecular formula C17H18Cl5N5 and a molecular weight of 469.63 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-[(1-methylpiperidin-2-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-[(1-methylpiperidin-2-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 566732 |
| Molecular Formula | C17H18Cl5N5 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-[(1-methylpiperidin-2-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CN1CCCCC1CNc1nc(-c2ccc(Cl)c(Cl)c2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C17H18Cl5N5/c1-27-7-3-2-4-11(27)9-23-16-25-14(24-15(26-16)17(20,21)22)10-5-6-12(18)13(19)8-10/h5-6,8,11H,2-4,7,9H2,1H3,(H,23,24,25,26) |
| InChIKey | HKEPPBSAECZRMA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|