C26H22Br2F2N4O2 — CID 56673282
6-bromo-2-[5-[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione bromide (PubChem CID 56673282) has the molecular formula C26H22Br2F2N4O2 and a molecular weight of 620.29 g/mol. Its IUPAC name is 6-bromo-2-[5-[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione bromide.
| Compound Name | 6-bromo-2-[5-[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione bromide |
|---|---|
| PubChem CID | 56673282 |
| Molecular Formula | C26H22Br2F2N4O2 |
| Molecular Weight | 620.29 g/mol |
| Exact Mass | 618.01 |
| IUPAC Name | 6-bromo-2-[5-[4-[(2,4-difluorophenyl)methyl]-1,2,4-triazol-4-ium-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione bromide |
| SMILES | O=C1c2cccc3c(Br)ccc(c23)C(=O)N1CCCCCn1c[n+](Cc2ccc(F)cc2F)cn1.[Br-] |
| InChI | InChI=1S/C26H22BrF2N4O2.BrH/c27-22-10-9-21-24-19(22)5-4-6-20(24)25(34)33(26(21)35)12-3-1-2-11-32-16-31(15-30-32)14-17-7-8-18(28)13-23(17)29;/h4-10,13,15-16H,1-3,11-12,14H2;1H/q+1;/p-1 |
| InChIKey | FZEODKDTHZLPIV-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|