About 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine
3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine (PubChem CID 56673311) has the molecular formula C18H18F3N5O
and a molecular weight of 377.37 g/mol. Its IUPAC name is 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine |
| PubChem CID | 56673311 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine |
| SMILES | Cc1nnc(N2CCCC2)c2nn(-c3ccc(OC(F)(F)F)cc3)c(C)c12 |
| InChI | InChI=1S/C18H18F3N5O/c1-11-15-12(2)26(13-5-7-14(8-6-13)27-18(19,20)21)24-16(15)17(23-22-11)25-9-3-4-10-25/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | IHJFGPKQEKFKLS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine?
The IUPAC name of 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine (CID 56673311) is 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine.
What is the SMILES notation for 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine?
The canonical SMILES for 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine is Cc1nnc(N2CCCC2)c2nn(-c3ccc(OC(F)(F)F)cc3)c(C)c12.
What is the InChIKey of 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine?
The InChIKey is IHJFGPKQEKFKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3N5O/c1-11-15-12(2)26(13-5-7-14(8-6-13)27-18(19,20)21)24-16(15)17(23-22-11)25-9-3-4-10-25/h5-8H,3-4,9-10H2,1-2H3.
What are the key properties of 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine?
3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine has a molecular weight of 377.37 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-7-pyrrolidin-1-yl-2-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyridazine is sourced from PubChem (CID 56673311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).