C25H37NO — CID 56673339
(2E,4E,6E,8E)-3,7-dimethyl-1-piperidin-1-yl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 56673339) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-1-piperidin-1-yl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-1-piperidin-1-yl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 56673339 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-1-piperidin-1-yl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)N2CCCCC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H37NO/c1-20(14-15-23-22(3)13-10-16-25(23,4)5)11-9-12-21(2)19-24(27)26-17-7-6-8-18-26/h9,11-12,14-15,19H,6-8,10,13,16-18H2,1-5H3/b12-9+,15-14+,20-11+,21-19+ |
| InChIKey | OEDUHIFYGOKQTJ-COIZJCGZSA-N |
| XLogP | 6.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|