C36H23F3N4O2 — CID 56673417
N-methyl-4-[4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 56673417) has the molecular formula C36H23F3N4O2 and a molecular weight of 600.60 g/mol. Its IUPAC name is N-methyl-4-[4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-methyl-4-[4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 56673417 |
| Molecular Formula | C36H23F3N4O2 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | N-methyl-4-[4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(-n3c(=O)ccc4cnc5ccc(-c6cnc7ccccc7c6)cc5c43)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H23F3N4O2/c1-40-35(45)22-8-6-21(7-9-22)28-13-12-27(18-30(28)36(37,38)39)43-33(44)15-11-25-19-42-32-14-10-23(17-29(32)34(25)43)26-16-24-4-2-3-5-31(24)41-20-26/h2-20H,1H3,(H,40,45) |
| InChIKey | MHSSNLFVZXULNC-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|