C25H25NO — CID 56673445
(2S,3R,6R)-2,6-bis(2-methylphenyl)-3-phenylpiperidin-4-one (PubChem CID 56673445) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is (2S,3R,6R)-2,6-bis(2-methylphenyl)-3-phenylpiperidin-4-one.
| Compound Name | (2S,3R,6R)-2,6-bis(2-methylphenyl)-3-phenylpiperidin-4-one |
|---|---|
| PubChem CID | 56673445 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2S,3R,6R)-2,6-bis(2-methylphenyl)-3-phenylpiperidin-4-one |
| SMILES | Cc1ccccc1[C@H]1N[C@@H](c2ccccc2C)CC(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H25NO/c1-17-10-6-8-14-20(17)22-16-23(27)24(19-12-4-3-5-13-19)25(26-22)21-15-9-7-11-18(21)2/h3-15,22,24-26H,16H2,1-2H3/t22-,24+,25-/m1/s1 |
| InChIKey | QKGYKUTZNDUDHD-PZUNEJSGSA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |