C20H24O4 — CID 56673601
(3S)-15-hydroxy-3,7,7-trimethyl-13-propan-2-yl-5-oxatricyclo[9.4.0.03,8]pentadeca-1(15),8,10,12-tetraene-4,14-dione (PubChem CID 56673601) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3S)-15-hydroxy-3,7,7-trimethyl-13-propan-2-yl-5-oxatricyclo[9.4.0.03,8]pentadeca-1(15),8,10,12-tetraene-4,14-dione.
| Compound Name | (3S)-15-hydroxy-3,7,7-trimethyl-13-propan-2-yl-5-oxatricyclo[9.4.0.03,8]pentadeca-1(15),8,10,12-tetraene-4,14-dione |
|---|---|
| PubChem CID | 56673601 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3S)-15-hydroxy-3,7,7-trimethyl-13-propan-2-yl-5-oxatricyclo[9.4.0.03,8]pentadeca-1(15),8,10,12-tetraene-4,14-dione |
| SMILES | CC(C)C1=CC2=CC=C3C(C)(C)COC(=O)[C@@]3(C)CC2=C(O)C1=O |
| InChI | InChI=1S/C20H24O4/c1-11(2)13-8-12-6-7-15-19(3,4)10-24-18(23)20(15,5)9-14(12)17(22)16(13)21/h6-8,11,22H,9-10H2,1-5H3/t20-/m0/s1 |
| InChIKey | RZVOPZIGXRIWOR-FQEVSTJZSA-N |
| XLogP | 3.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |