C22H19ClF3N3O4 — CID 56673650
N-[(Z)-1-chloro-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]-4-nitro-2-(trifluoromethyl)benzamide (PubChem CID 56673650) has the molecular formula C22H19ClF3N3O4 and a molecular weight of 481.86 g/mol. Its IUPAC name is N-[(Z)-1-chloro-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]-4-nitro-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-1-chloro-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]-4-nitro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 56673650 |
| Molecular Formula | C22H19ClF3N3O4 |
| Molecular Weight | 481.86 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-[(Z)-1-chloro-3-oxo-1-phenyl-3-piperidin-1-ylprop-1-en-2-yl]-4-nitro-2-(trifluoromethyl)benzamide |
| SMILES | O=C(N/C(C(=O)N1CCCCC1)=C(\Cl)c1ccccc1)c1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C22H19ClF3N3O4/c23-18(14-7-3-1-4-8-14)19(21(31)28-11-5-2-6-12-28)27-20(30)16-10-9-15(29(32)33)13-17(16)22(24,25)26/h1,3-4,7-10,13H,2,5-6,11-12H2,(H,27,30)/b19-18- |
| InChIKey | ITCTVQHAWXRREG-HNENSFHCSA-N |
| XLogP | 4.96 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.86 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|