C21H28O5S — CID 56673701
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-5-[(4-propylphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol (PubChem CID 56673701) has the molecular formula C21H28O5S and a molecular weight of 392.52 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-5-[(4-propylphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-5-[(4-propylphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56673701 |
| Molecular Formula | C21H28O5S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-5-[(4-propylphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol |
| SMILES | CCCc1ccc(Cc2sc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2C)cc1 |
| InChI | InChI=1S/C21H28O5S/c1-3-4-13-5-7-14(8-6-13)10-16-12(2)9-17(27-16)21-20(25)19(24)18(23)15(11-22)26-21/h5-9,15,18-25H,3-4,10-11H2,1-2H3/t15-,18-,19+,20-,21+/m1/s1 |
| InChIKey | HDZGUPFVEHRNJD-GRARQNNCSA-N |
| XLogP | 2.11 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |