C10H20O4 — CID 56673704
(1R)-1-[(3S,4R)-4-ethyl-6,6-dimethyldioxan-3-yl]ethane-1,2-diol (PubChem CID 56673704) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (1R)-1-[(3S,4R)-4-ethyl-6,6-dimethyldioxan-3-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3S,4R)-4-ethyl-6,6-dimethyldioxan-3-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 56673704 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (1R)-1-[(3S,4R)-4-ethyl-6,6-dimethyldioxan-3-yl]ethane-1,2-diol |
| SMILES | CC[C@@H]1CC(C)(C)OO[C@@H]1[C@H](O)CO |
| InChI | InChI=1S/C10H20O4/c1-4-7-5-10(2,3)14-13-9(7)8(12)6-11/h7-9,11-12H,4-6H2,1-3H3/t7-,8-,9+/m1/s1 |
| InChIKey | LVVLDVKMIWDDBF-HLTSFMKQSA-N |
| XLogP | 0.86 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|