About 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile
4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile (PubChem CID 56673735) has the molecular formula C23H17ClN4O2
and a molecular weight of 416.87 g/mol. Its IUPAC name is 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile |
| PubChem CID | 56673735 |
| Molecular Formula | C23H17ClN4O2 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(Cl)cc(C)c1Oc1nn(Nc2ccc(C#N)cc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H17ClN4O2/c1-14-11-17(24)12-15(2)21(14)30-22-19-5-3-4-6-20(19)23(29)28(27-22)26-18-9-7-16(13-25)8-10-18/h3-12,26H,1-2H3 |
| InChIKey | FZIIEXXNSAMTPZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile?
The IUPAC name of 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile (CID 56673735) is 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile?
The canonical SMILES for 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile is Cc1cc(Cl)cc(C)c1Oc1nn(Nc2ccc(C#N)cc2)c(=O)c2ccccc12.
What is the InChIKey of 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile?
The InChIKey is FZIIEXXNSAMTPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17ClN4O2/c1-14-11-17(24)12-15(2)21(14)30-22-19-5-3-4-6-20(19)23(29)28(27-22)26-18-9-7-16(13-25)8-10-18/h3-12,26H,1-2H3.
What are the key properties of 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile?
4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile has a molecular weight of 416.87 g/mol, XLogP of 5.21, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4-chloro-2,6-dimethylphenoxy)-1-oxophthalazin-2-yl]amino]benzonitrile is sourced from PubChem (CID 56673735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).