C32H37N5O2 — CID 56673945
(6aR,9R)-N-phenyl-9-(pyrrolidine-1-carbonyl)-4-(2-pyrrolidin-1-ylethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide (PubChem CID 56673945) has the molecular formula C32H37N5O2 and a molecular weight of 523.68 g/mol. Its IUPAC name is (6aR,9R)-N-phenyl-9-(pyrrolidine-1-carbonyl)-4-(2-pyrrolidin-1-ylethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide.
| Compound Name | (6aR,9R)-N-phenyl-9-(pyrrolidine-1-carbonyl)-4-(2-pyrrolidin-1-ylethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 56673945 |
| Molecular Formula | C32H37N5O2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | (6aR,9R)-N-phenyl-9-(pyrrolidine-1-carbonyl)-4-(2-pyrrolidin-1-ylethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide |
| SMILES | O=C([C@@H]1C=C2c3cccc4c3c(cn4CCN3CCCC3)C[C@H]2N(C(=O)Nc2ccccc2)C1)N1CCCC1 |
| InChI | InChI=1S/C32H37N5O2/c38-31(35-15-6-7-16-35)24-19-27-26-11-8-12-28-30(26)23(21-36(28)18-17-34-13-4-5-14-34)20-29(27)37(22-24)32(39)33-25-9-2-1-3-10-25/h1-3,8-12,19,21,24,29H,4-7,13-18,20,22H2,(H,33,39)/t24-,29-/m1/s1 |
| InChIKey | ODGLLEQMXCBDJJ-FUFSCUOVSA-N |
| XLogP | 4.83 |
| TPSA | 60.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|