C24H38O7 — CID 56673951
4-O-tert-butyl 1-O-[(3E,6S,16R)-16-methyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl] butanedioate (PubChem CID 56673951) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(3E,6S,16R)-16-methyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl] butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(3E,6S,16R)-16-methyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl] butanedioate |
|---|---|
| PubChem CID | 56673951 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(3E,6S,16R)-16-methyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl] butanedioate |
| SMILES | C[C@@H]1CCCCCCCCC[C@H](OC(=O)CCC(=O)OC(C)(C)C)C(=O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C24H38O7/c1-18-12-10-8-6-5-7-9-11-13-20(19(25)14-15-21(26)29-18)30-22(27)16-17-23(28)31-24(2,3)4/h14-15,18,20H,5-13,16-17H2,1-4H3/b15-14+/t18-,20+/m1/s1 |
| InChIKey | LPLAACNLNHQITO-CQMOJKFWSA-N |
| XLogP | 4.60 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|