C41H64O11 — CID 56674223
methyl 10-acetyloxy-9-(acetyloxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-12-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylate (PubChem CID 56674223) has the molecular formula C41H64O11 and a molecular weight of 732.95 g/mol. Its IUPAC name is methyl 10-acetyloxy-9-(acetyloxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-12-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylate.
| Compound Name | methyl 10-acetyloxy-9-(acetyloxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-12-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 56674223 |
| Molecular Formula | C41H64O11 |
| Molecular Weight | 732.95 g/mol |
| Exact Mass | 732.44 |
| IUPAC Name | methyl 10-acetyloxy-9-(acetyloxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-12-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylate |
| SMILES | COC(=O)C1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)C(OC6OC(C)C(O)C(O)C6O)CC(OC(C)=O)C(C)(COC(C)=O)C5CCC43C)C2C1 |
| InChI | InChI=1S/C41H64O11/c1-22-31(44)32(45)33(46)34(50-22)52-30-19-29(51-24(3)43)38(6,21-49-23(2)42)27-13-14-40(8)28(41(27,30)9)12-11-25-26-20-37(5,35(47)48-10)16-15-36(26,4)17-18-39(25,40)7/h11,22,26-34,44-46H,12-21H2,1-10H3 |
| InChIKey | LGADBFMTBLRZEN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.95 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|