C14H18F3NO3S — CID 56674276
[7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 56674276) has the molecular formula C14H18F3NO3S and a molecular weight of 337.36 g/mol. Its IUPAC name is [7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 56674276 |
| Molecular Formula | C14H18F3NO3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | [7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CCCNC1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C14H18F3NO3S/c1-2-7-18-12-5-3-10-4-6-13(9-11(10)8-12)21-22(19,20)14(15,16)17/h4,6,9,12,18H,2-3,5,7-8H2,1H3 |
| InChIKey | YIJDPVLWVKAIMO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|