C25H35N4O12P — CID 56675167
(2S,3R)-2-[[(2S,5S,8S)-5-(2-carboxyethyl)-3,6,11-trioxo-2-[(4-phosphonooxyphenyl)methyl]-1,4,7-triazacycloundecane-8-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 56675167) has the molecular formula C25H35N4O12P and a molecular weight of 614.55 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S,5S,8S)-5-(2-carboxyethyl)-3,6,11-trioxo-2-[(4-phosphonooxyphenyl)methyl]-1,4,7-triazacycloundecane-8-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[[(2S,5S,8S)-5-(2-carboxyethyl)-3,6,11-trioxo-2-[(4-phosphonooxyphenyl)methyl]-1,4,7-triazacycloundecane-8-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 56675167 |
| Molecular Formula | C25H35N4O12P |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | (2S,3R)-2-[[(2S,5S,8S)-5-(2-carboxyethyl)-3,6,11-trioxo-2-[(4-phosphonooxyphenyl)methyl]-1,4,7-triazacycloundecane-8-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NC(=O)[C@@H]1CCC(=O)N[C@@H](Cc2ccc(OP(=O)(O)O)cc2)C(=O)N[C@@H](CCC(=O)O)C(=O)N1)C(=O)O |
| InChI | InChI=1S/C25H35N4O12P/c1-3-13(2)21(25(36)37)29-23(34)16-8-10-19(30)26-18(12-14-4-6-15(7-5-14)41-42(38,39)40)24(35)28-17(22(33)27-16)9-11-20(31)32/h4-7,13,16-18,21H,3,8-12H2,1-2H3,(H,26,30)(H,27,33)(H,28,35)(H,29,34)(H,31,32)(H,36,37)(H2,38,39,40)/t13-,16+,17+,18+,21+/m1/s1 |
| InChIKey | OYMJCIOTJSKMRH-BEACGEKWSA-N |
| XLogP | -0.57 |
| TPSA | 257.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|