C27H27N3O4 — CID 56675204
N-(1,3-benzodioxol-5-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine (PubChem CID 56675204) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 56675204 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine |
| SMILES | COc1ccc(Oc2ccc3c(NCCCNCc4ccc5c(c4)OCO5)ccnc3c2)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-31-20-4-6-21(7-5-20)34-22-8-9-23-24(11-14-30-25(23)16-22)29-13-2-12-28-17-19-3-10-26-27(15-19)33-18-32-26/h3-11,14-16,28H,2,12-13,17-18H2,1H3,(H,29,30) |
| InChIKey | HMGFJXJAJMXYQT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|