About N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide
N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide (PubChem CID 56675502) has the molecular formula C21H24N2O5
and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide |
| PubChem CID | 56675502 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide |
| SMILES | COc1ccc(OC)c(C(CC(=O)c2cccc(NC(C)=O)c2)NC(C)=O)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-13(24)22-16-7-5-6-15(10-16)20(26)12-19(23-14(2)25)18-11-17(27-3)8-9-21(18)28-4/h5-11,19H,12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | VSOTTZCLSMTQRK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide?
The IUPAC name of N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide (CID 56675502) is N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide.
What is the SMILES notation for N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide?
The canonical SMILES for N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide is COc1ccc(OC)c(C(CC(=O)c2cccc(NC(C)=O)c2)NC(C)=O)c1.
What is the InChIKey of N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide?
The InChIKey is VSOTTZCLSMTQRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O5/c1-13(24)22-16-7-5-6-15(10-16)20(26)12-19(23-14(2)25)18-11-17(27-3)8-9-21(18)28-4/h5-11,19H,12H2,1-4H3,(H,22,24)(H,23,25).
What are the key properties of N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide?
N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide has a molecular weight of 384.43 g/mol, XLogP of 3.11, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3-acetamido-3-(2,5-dimethoxyphenyl)propanoyl]phenyl]acetamide is sourced from PubChem (CID 56675502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).