C20H21N3O3S — CID 56675693
6,7-dimethoxy-3-(4-methoxyphenyl)-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide (PubChem CID 56675693) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 6,7-dimethoxy-3-(4-methoxyphenyl)-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide.
| Compound Name | 6,7-dimethoxy-3-(4-methoxyphenyl)-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 56675693 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 6,7-dimethoxy-3-(4-methoxyphenyl)-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
| SMILES | COc1ccc(C2C3Cc4cc(OC)c(OC)cc4C3=NN2C(N)=S)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-24-13-6-4-11(5-7-13)19-15-8-12-9-16(25-2)17(26-3)10-14(12)18(15)22-23(19)20(21)27/h4-7,9-10,15,19H,8H2,1-3H3,(H2,21,27) |
| InChIKey | BBFMOMYMNDDVAB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|