About (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol
(4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol (PubChem CID 56675888) has the molecular formula C18H12ClF2NO
and a molecular weight of 331.75 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol |
| PubChem CID | 56675888 |
| Molecular Formula | C18H12ClF2NO |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol |
| SMILES | OC(c1ccc(Cl)cc1)(c1cccnc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H12ClF2NO/c19-14-5-3-12(4-6-14)18(23,13-2-1-9-22-11-13)16-8-7-15(20)10-17(16)21/h1-11,23H |
| InChIKey | MXBQCLOKSYXOLR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol?
The IUPAC name of (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol (CID 56675888) is (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol.
What is the SMILES notation for (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol?
The canonical SMILES for (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol is OC(c1ccc(Cl)cc1)(c1cccnc1)c1ccc(F)cc1F.
What is the InChIKey of (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol?
The InChIKey is MXBQCLOKSYXOLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClF2NO/c19-14-5-3-12(4-6-14)18(23,13-2-1-9-22-11-13)16-8-7-15(20)10-17(16)21/h1-11,23H.
What are the key properties of (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol?
(4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol has a molecular weight of 331.75 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-(2,4-difluorophenyl)-pyridin-3-ylmethanol is sourced from PubChem (CID 56675888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).