C15H15N3OS — CID 56676111
2-pyridin-2-yl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine (PubChem CID 56676111) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-pyridin-2-yl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine.
| Compound Name | 2-pyridin-2-yl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 56676111 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-pyridin-2-yl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine |
| SMILES | c1ccc(CCNCc2coc(-c3cccs3)n2)nc1 |
| InChI | InChI=1S/C15H15N3OS/c1-2-7-17-12(4-1)6-8-16-10-13-11-19-15(18-13)14-5-3-9-20-14/h1-5,7,9,11,16H,6,8,10H2 |
| InChIKey | FCCBOKBTXOVLPQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|