C22H20ClN3 — CID 56676119
N-[(4-chlorophenyl)-pyridin-3-ylmethyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 56676119) has the molecular formula C22H20ClN3 and a molecular weight of 361.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-pyridin-3-ylmethyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[(4-chlorophenyl)-pyridin-3-ylmethyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 56676119 |
| Molecular Formula | C22H20ClN3 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[(4-chlorophenyl)-pyridin-3-ylmethyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | Clc1ccc(C(NCCc2c[nH]c3ccccc23)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H20ClN3/c23-19-9-7-16(8-10-19)22(18-4-3-12-24-14-18)25-13-11-17-15-26-21-6-2-1-5-20(17)21/h1-10,12,14-15,22,25-26H,11,13H2 |
| InChIKey | ZCVKSSVHTLGOKT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |