About N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline
N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline (PubChem CID 56676278) has the molecular formula C19H19BrN2O
and a molecular weight of 371.28 g/mol. Its IUPAC name is N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline.
Molecular Properties
| Compound Name | N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline |
| PubChem CID | 56676278 |
| Molecular Formula | C19H19BrN2O |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline |
| SMILES | CC(C)c1ccc(NCc2coc(-c3ccccc3Br)n2)cc1 |
| InChI | InChI=1S/C19H19BrN2O/c1-13(2)14-7-9-15(10-8-14)21-11-16-12-23-19(22-16)17-5-3-4-6-18(17)20/h3-10,12-13,21H,11H2,1-2H3 |
| InChIKey | NJWFWWYVHHMPKL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline?
The IUPAC name of N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline (CID 56676278) is N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline.
What is the SMILES notation for N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline?
The canonical SMILES for N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline is CC(C)c1ccc(NCc2coc(-c3ccccc3Br)n2)cc1.
What is the InChIKey of N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline?
The InChIKey is NJWFWWYVHHMPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrN2O/c1-13(2)14-7-9-15(10-8-14)21-11-16-12-23-19(22-16)17-5-3-4-6-18(17)20/h3-10,12-13,21H,11H2,1-2H3.
What are the key properties of N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline?
N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline has a molecular weight of 371.28 g/mol, XLogP of 5.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]-4-propan-2-ylaniline is sourced from PubChem (CID 56676278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).