About 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole
8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole (PubChem CID 56676380) has the molecular formula C18H15FN2
and a molecular weight of 278.33 g/mol. Its IUPAC name is 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole.
Molecular Properties
| Compound Name | 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole |
| PubChem CID | 56676380 |
| Molecular Formula | C18H15FN2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole |
| SMILES | Cc1c2cnccc2c(C)c2c1c1ccc(F)cc1n2C |
| InChI | InChI=1S/C18H15FN2/c1-10-15-9-20-7-6-13(15)11(2)18-17(10)14-5-4-12(19)8-16(14)21(18)3/h4-9H,1-3H3 |
| InChIKey | PAHILWLNVCSANG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole?
The IUPAC name of 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole (CID 56676380) is 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole.
What is the SMILES notation for 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole?
The canonical SMILES for 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole is Cc1c2cnccc2c(C)c2c1c1ccc(F)cc1n2C.
What is the InChIKey of 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole?
The InChIKey is PAHILWLNVCSANG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2/c1-10-15-9-20-7-6-13(15)11(2)18-17(10)14-5-4-12(19)8-16(14)21(18)3/h4-9H,1-3H3.
What are the key properties of 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole?
8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole has a molecular weight of 278.33 g/mol, XLogP of 4.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5,6,11-trimethylpyrido[4,3-b]carbazole is sourced from PubChem (CID 56676380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).