C34H46O2 — CID 56676430
(2-cyclohexylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 56676430) has the molecular formula C34H46O2 and a molecular weight of 486.74 g/mol. Its IUPAC name is (2-cyclohexylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | (2-cyclohexylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 56676430 |
| Molecular Formula | C34H46O2 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | (2-cyclohexylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)Oc1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C34H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-30-34(35)36-33-29-25-24-28-32(33)31-26-21-20-22-27-31/h3-4,6-7,9-10,12-13,15-16,18-19,24-25,28-29,31H,2,5,8,11,14,17,20-23,26-27,30H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | BRARBEPBJCEKAU-KUBAVDMBSA-N |
| XLogP | 10.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|