C24H39N3O6S2 — CID 56676500
(1S,5S,6R,9S,15E,20R)-6-[(2S)-butan-2-yl]-20-butyl-5-hydroxy-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone (PubChem CID 56676500) has the molecular formula C24H39N3O6S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is (1S,5S,6R,9S,15E,20R)-6-[(2S)-butan-2-yl]-20-butyl-5-hydroxy-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone.
| Compound Name | (1S,5S,6R,9S,15E,20R)-6-[(2S)-butan-2-yl]-20-butyl-5-hydroxy-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
|---|---|
| PubChem CID | 56676500 |
| Molecular Formula | C24H39N3O6S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (1S,5S,6R,9S,15E,20R)-6-[(2S)-butan-2-yl]-20-butyl-5-hydroxy-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
| SMILES | CCCC[C@H]1NC(=O)C[C@H]2/C=C/CCSSCC(NC1=O)C(=O)N[C@H]([C@@H](C)CC)[C@@H](O)CC(=O)O2 |
| InChI | InChI=1S/C24H39N3O6S2/c1-4-6-10-17-23(31)26-18-14-35-34-11-8-7-9-16(12-20(29)25-17)33-21(30)13-19(28)22(15(3)5-2)27-24(18)32/h7,9,15-19,22,28H,4-6,8,10-14H2,1-3H3,(H,25,29)(H,26,31)(H,27,32)/b9-7+/t15-,16+,17+,18?,19-,22+/m0/s1 |
| InChIKey | MUNWAZFRKGVMPQ-PDHNIMEQSA-N |
| XLogP | 2.08 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|