C14H15NO2 — CID 56676627
6-methoxy-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 56676627) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 6-methoxy-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 6-methoxy-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 56676627 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 6-methoxy-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | COc1ccc2c(=O)c3c([nH]c2c1)CCCC3 |
| InChI | InChI=1S/C14H15NO2/c1-17-9-6-7-11-13(8-9)15-12-5-3-2-4-10(12)14(11)16/h6-8H,2-5H2,1H3,(H,15,16) |
| InChIKey | LSVXWLDSOHBOOX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |