C19H13FN4O — CID 56676664
4-(3-fluoroanilino)-5,13,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15)-hexaen-12-one (PubChem CID 56676664) has the molecular formula C19H13FN4O and a molecular weight of 332.34 g/mol. Its IUPAC name is 4-(3-fluoroanilino)-5,13,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15)-hexaen-12-one.
| Compound Name | 4-(3-fluoroanilino)-5,13,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15)-hexaen-12-one |
|---|---|
| PubChem CID | 56676664 |
| Molecular Formula | C19H13FN4O |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-(3-fluoroanilino)-5,13,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15)-hexaen-12-one |
| SMILES | O=C1NCc2[nH]c3c(ccc4cnc(Nc5cccc(F)c5)cc43)c21 |
| InChI | InChI=1S/C19H13FN4O/c20-11-2-1-3-12(6-11)23-16-7-14-10(8-21-16)4-5-13-17-15(24-18(13)14)9-22-19(17)25/h1-8,24H,9H2,(H,21,23)(H,22,25) |
| InChIKey | WKRRYRSXQAPECL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |