C29H24N4O3 — CID 56676765
2-naphthalen-1-yl-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide (PubChem CID 56676765) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-naphthalen-1-yl-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide.
| Compound Name | 2-naphthalen-1-yl-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 56676765 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-naphthalen-1-yl-1,3-dioxo-N-(2-phenylphenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)N1CCN2C(=O)N(c3cccc4ccccc34)C(=O)C2C1 |
| InChI | InChI=1S/C29H24N4O3/c34-27-26-19-31(28(35)30-24-15-7-6-13-22(24)20-9-2-1-3-10-20)17-18-32(26)29(36)33(27)25-16-8-12-21-11-4-5-14-23(21)25/h1-16,26H,17-19H2,(H,30,35) |
| InChIKey | KHLYDKCXTXXEAT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|