C15H19N3O3 — CID 56677120
(2S)-N-hydroxy-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 56677120) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2S)-N-hydroxy-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-hydroxy-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56677120 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (2S)-N-hydroxy-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NO)[C@@H]1CCCN1C(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C15H19N3O3/c19-14(17-21)13-6-3-7-18(13)15(20)12-8-10-4-1-2-5-11(10)9-16-12/h1-2,4-5,12-13,16,21H,3,6-9H2,(H,17,19)/t12-,13-/m0/s1 |
| InChIKey | QVZNGDRGGKZTJI-STQMWFEESA-N |
| XLogP | 0.20 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|