C21H19ClN2OSe — CID 56678501
(3R)-3-(4-chlorophenyl)-1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one (PubChem CID 56678501) has the molecular formula C21H19ClN2OSe and a molecular weight of 429.81 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one.
| Compound Name | (3R)-3-(4-chlorophenyl)-1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
|---|---|
| PubChem CID | 56678501 |
| Molecular Formula | C21H19ClN2OSe |
| Molecular Weight | 429.81 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-1-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
| SMILES | O=C(C[C@@H](c1ccc(Cl)cc1)[C@@H]1CCCc2[se]nnc21)c1ccccc1 |
| InChI | InChI=1S/C21H19ClN2OSe/c22-16-11-9-14(10-12-16)18(13-19(25)15-5-2-1-3-6-15)17-7-4-8-20-21(17)23-24-26-20/h1-3,5-6,9-12,17-18H,4,7-8,13H2/t17-,18-/m0/s1 |
| InChIKey | UVKFNFSNIIPYJE-ROUUACIJSA-N |
| XLogP | 4.66 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|