C13H25NO8 — CID 56678512
(2R,3S,4S,5R,6S)-2-[[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]methyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 56678512) has the molecular formula C13H25NO8 and a molecular weight of 323.34 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]methyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]methyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 56678512 |
| Molecular Formula | C13H25NO8 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]methyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@@H]1CN(C[C@H]2O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]2O)C[C@@H](CO)O1 |
| InChI | InChI=1S/C13H25NO8/c1-19-9-5-14(3-7(6-15)21-9)4-8-10(16)11(17)12(18)13(20-2)22-8/h7-13,15-18H,3-6H2,1-2H3/t7-,8+,9-,10+,11-,12+,13-/m0/s1 |
| InChIKey | LLTLUBIVTVODAB-OZRJGJILSA-N |
| XLogP | -2.89 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |