C18H27N3O — CID 56678949
N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 56678949) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 56678949 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[[2-(4-butylphenyl)-1,3-oxazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CCCCc1ccc(-c2nc(CNCCN(C)C)co2)cc1 |
| InChI | InChI=1S/C18H27N3O/c1-4-5-6-15-7-9-16(10-8-15)18-20-17(14-22-18)13-19-11-12-21(2)3/h7-10,14,19H,4-6,11-13H2,1-3H3 |
| InChIKey | HBUUXNLLVVXMKF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|