C19H17N5OS — CID 56678999
2-amino-3-methyl-5-(2-methylthiophen-3-yl)-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one (PubChem CID 56678999) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-amino-3-methyl-5-(2-methylthiophen-3-yl)-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one.
| Compound Name | 2-amino-3-methyl-5-(2-methylthiophen-3-yl)-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 56678999 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-amino-3-methyl-5-(2-methylthiophen-3-yl)-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one |
| SMILES | Cc1sccc1C1(c2cccc(-c3cncnc3)c2)N=C(N)N(C)C1=O |
| InChI | InChI=1S/C19H17N5OS/c1-12-16(6-7-26-12)19(17(25)24(2)18(20)23-19)15-5-3-4-13(8-15)14-9-21-11-22-10-14/h3-11H,1-2H3,(H2,20,23) |
| InChIKey | AWSZXXRYNSNVQU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |