C19H15FN4OS — CID 56679000
2-amino-5-(4-fluoro-3-pyridin-3-ylphenyl)-3-methyl-5-thiophen-3-ylimidazol-4-one (PubChem CID 56679000) has the molecular formula C19H15FN4OS and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-amino-5-(4-fluoro-3-pyridin-3-ylphenyl)-3-methyl-5-thiophen-3-ylimidazol-4-one.
| Compound Name | 2-amino-5-(4-fluoro-3-pyridin-3-ylphenyl)-3-methyl-5-thiophen-3-ylimidazol-4-one |
|---|---|
| PubChem CID | 56679000 |
| Molecular Formula | C19H15FN4OS |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-amino-5-(4-fluoro-3-pyridin-3-ylphenyl)-3-methyl-5-thiophen-3-ylimidazol-4-one |
| SMILES | CN1C(=O)C(c2ccsc2)(c2ccc(F)c(-c3cccnc3)c2)N=C1N |
| InChI | InChI=1S/C19H15FN4OS/c1-24-17(25)19(23-18(24)21,14-6-8-26-11-14)13-4-5-16(20)15(9-13)12-3-2-7-22-10-12/h2-11H,1H3,(H2,21,23) |
| InChIKey | SXYPETJOWBBGQK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |