About [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate
[4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate (PubChem CID 56679255) has the molecular formula C20H26N4O4
and a molecular weight of 386.45 g/mol. Its IUPAC name is [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate |
| PubChem CID | 56679255 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCn1cc(C(O)c2ccc3c(c2)C=CC(C)(C)O3)nn1 |
| InChI | InChI=1S/C20H26N4O4/c1-5-23(6-2)19(26)27-13-24-12-16(21-22-24)18(25)15-7-8-17-14(11-15)9-10-20(3,4)28-17/h7-12,18,25H,5-6,13H2,1-4H3 |
| InChIKey | ROLKGGNESCBACX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate?
The IUPAC name of [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate (CID 56679255) is [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate.
What is the SMILES notation for [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate?
The canonical SMILES for [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate is CCN(CC)C(=O)OCn1cc(C(O)c2ccc3c(c2)C=CC(C)(C)O3)nn1.
What is the InChIKey of [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate?
The InChIKey is ROLKGGNESCBACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O4/c1-5-23(6-2)19(26)27-13-24-12-16(21-22-24)18(25)15-7-8-17-14(11-15)9-10-20(3,4)28-17/h7-12,18,25H,5-6,13H2,1-4H3.
What are the key properties of [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate?
[4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate has a molecular weight of 386.45 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,2-dimethylchromen-6-yl)-hydroxymethyl]triazol-1-yl]methyl N,N-diethylcarbamate is sourced from PubChem (CID 56679255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).