C19H13ClF3N3O — CID 56679470
4-chloro-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 56679470) has the molecular formula C19H13ClF3N3O and a molecular weight of 391.78 g/mol. Its IUPAC name is 4-chloro-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-chloro-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 56679470 |
| Molecular Formula | C19H13ClF3N3O |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 4-chloro-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NC(c1ccc(C(F)(F)F)cc1)c1cnccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClF3N3O/c20-15-7-3-13(4-8-15)18(27)26-17(16-11-24-9-10-25-16)12-1-5-14(6-2-12)19(21,22)23/h1-11,17H,(H,26,27) |
| InChIKey | XVPDBCXWMNGLBB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |