C21H28N2O6 — CID 56679558
(E)-but-2-enedioic acid;11-(dipropylamino)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one (PubChem CID 56679558) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;11-(dipropylamino)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one.
| Compound Name | (E)-but-2-enedioic acid;11-(dipropylamino)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
|---|---|
| PubChem CID | 56679558 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (E)-but-2-enedioic acid;11-(dipropylamino)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
| SMILES | CCCN(CCC)C1Cc2cccc3c2N(C1)C(=O)CO3.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H24N2O2.C4H4O4/c1-3-8-18(9-4-2)14-10-13-6-5-7-15-17(13)19(11-14)16(20)12-21-15;5-3(6)1-2-4(7)8/h5-7,14H,3-4,8-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ADURWEGLCHCIQH-WLHGVMLRSA-N |
| XLogP | 2.17 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|