C24H32N2O3 — CID 56679669
4-[(5R,6R,9S,13S)-7-[(E)-3-phenylprop-2-enoyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 56679669) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-[(E)-3-phenylprop-2-enoyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5R,6R,9S,13S)-7-[(E)-3-phenylprop-2-enoyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 56679669 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-[(E)-3-phenylprop-2-enoyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)/C=C/c1ccccc1)[C@@H]23 |
| InChI | InChI=1S/C24H32N2O3/c27-22(14-13-18-7-2-1-3-8-18)26-17-19-9-5-15-25-16-6-10-20(24(19)25)21(26)11-4-12-23(28)29/h1-3,7-8,13-14,19-21,24H,4-6,9-12,15-17H2,(H,28,29)/b14-13+/t19-,20+,21+,24-/m0/s1 |
| InChIKey | JAXFIRDYWRYOIP-AIZWVGSRSA-N |
| XLogP | 3.66 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|