C17H20O7S — CID 56679722
methyl 2-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-prop-2-ynoxyoxan-2-yl]sulfanylbenzoate (PubChem CID 56679722) has the molecular formula C17H20O7S and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-prop-2-ynoxyoxan-2-yl]sulfanylbenzoate.
| Compound Name | methyl 2-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-prop-2-ynoxyoxan-2-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 56679722 |
| Molecular Formula | C17H20O7S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl 2-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-prop-2-ynoxyoxan-2-yl]sulfanylbenzoate |
| SMILES | C#CCO[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](Sc2ccccc2C(=O)OC)[C@@H]1O |
| InChI | InChI=1S/C17H20O7S/c1-3-8-23-15-13(19)11(9-18)24-17(14(15)20)25-12-7-5-4-6-10(12)16(21)22-2/h1,4-7,11,13-15,17-20H,8-9H2,2H3/t11-,13+,14-,15+,17+/m1/s1 |
| InChIKey | OPVMOQUONNGPEK-DHWSYENGSA-N |
| XLogP | 0.02 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|