About 4-morpholin-4-ylbutane-1,3-diol
4-morpholin-4-ylbutane-1,3-diol (PubChem CID 56679802) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-morpholin-4-ylbutane-1,3-diol.
Molecular Properties
| Compound Name | 4-morpholin-4-ylbutane-1,3-diol |
| PubChem CID | 56679802 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 4-morpholin-4-ylbutane-1,3-diol |
| SMILES | OCCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C8H17NO3/c10-4-1-8(11)7-9-2-5-12-6-3-9/h8,10-11H,1-7H2 |
| InChIKey | CFOHHMITBKLUEM-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-morpholin-4-ylbutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-ylbutane-1,3-diol?
The IUPAC name of 4-morpholin-4-ylbutane-1,3-diol (CID 56679802) is 4-morpholin-4-ylbutane-1,3-diol.
What is the SMILES notation for 4-morpholin-4-ylbutane-1,3-diol?
The canonical SMILES for 4-morpholin-4-ylbutane-1,3-diol is OCCC(O)CN1CCOCC1.
What is the InChIKey of 4-morpholin-4-ylbutane-1,3-diol?
The InChIKey is CFOHHMITBKLUEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c10-4-1-8(11)7-9-2-5-12-6-3-9/h8,10-11H,1-7H2.
What are the key properties of 4-morpholin-4-ylbutane-1,3-diol?
4-morpholin-4-ylbutane-1,3-diol has a molecular weight of 175.23 g/mol, XLogP of -0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-ylbutane-1,3-diol is sourced from PubChem (CID 56679802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).