C23H26N4O6 — CID 56679831
[(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 2-methyl-3-nitrobenzoate (PubChem CID 56679831) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 2-methyl-3-nitrobenzoate.
| Compound Name | [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 56679831 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OC[C@H]2OC(=O)N[C@@H]2CN2CCN(c3ccccc3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26N4O6/c1-16-18(8-5-9-20(16)27(30)31)22(28)32-15-21-19(24-23(29)33-21)14-25-10-12-26(13-11-25)17-6-3-2-4-7-17/h2-9,19,21H,10-15H2,1H3,(H,24,29)/t19-,21-/m1/s1 |
| InChIKey | PWEPIOVOEOYCAT-TZIWHRDSSA-N |
| XLogP | 2.36 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|