C26H34N4O4+2 — CID 56679895
[13-[[diethyl(methyl)azaniumyl]methyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl-diethyl-methylazanium (PubChem CID 56679895) has the molecular formula C26H34N4O4+2 and a molecular weight of 466.58 g/mol. Its IUPAC name is [13-[[diethyl(methyl)azaniumyl]methyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl-diethyl-methylazanium.
| Compound Name | [13-[[diethyl(methyl)azaniumyl]methyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 56679895 |
| Molecular Formula | C26H34N4O4+2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [13-[[diethyl(methyl)azaniumyl]methyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(C[N+](C)(CC)CC)C3=O |
| InChI | InChI=1S/C26H34N4O4/c1-7-29(5,8-2)15-27-23(31)17-11-13-19-22-20(14-12-18(21(17)22)24(27)32)26(34)28(25(19)33)16-30(6,9-3)10-4/h11-14H,7-10,15-16H2,1-6H3/q+2 |
| InChIKey | BNEHHRDLOWGFMQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|