About 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine
9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine (PubChem CID 56679930) has the molecular formula C12H14ClN5
and a molecular weight of 263.73 g/mol. Its IUPAC name is 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine.
Molecular Properties
| Compound Name | 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine |
| PubChem CID | 56679930 |
| Molecular Formula | C12H14ClN5 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine |
| SMILES | Nc1nc(Cl)c2ncn([C@@H]3C[C@H]4CC[C@@H]3C4)c2n1 |
| InChI | InChI=1S/C12H14ClN5/c13-10-9-11(17-12(14)16-10)18(5-15-9)8-4-6-1-2-7(8)3-6/h5-8H,1-4H2,(H2,14,16,17)/t6-,7+,8+/m0/s1 |
| InChIKey | CGIUANFKJQRKIM-XLPZGREQSA-N |
| XLogP | 2.42 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine?
The IUPAC name of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine (CID 56679930) is 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine.
What is the SMILES notation for 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine?
The canonical SMILES for 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine is Nc1nc(Cl)c2ncn([C@@H]3C[C@H]4CC[C@@H]3C4)c2n1.
What is the InChIKey of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine?
The InChIKey is CGIUANFKJQRKIM-XLPZGREQSA-N. The full InChI is InChI=1S/C12H14ClN5/c13-10-9-11(17-12(14)16-10)18(5-15-9)8-4-6-1-2-7(8)3-6/h5-8H,1-4H2,(H2,14,16,17)/t6-,7+,8+/m0/s1.
What are the key properties of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine?
9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine has a molecular weight of 263.73 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloropurin-2-amine is sourced from PubChem (CID 56679930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).