C24H35NO — CID 56679962
(2E,4E,6E,8E)-N-(cyclopropylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 56679962) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(cyclopropylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(cyclopropylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 56679962 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | (2E,4E,6E,8E)-N-(cyclopropylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NCC2CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H35NO/c1-18(11-14-22-20(3)10-7-15-24(22,4)5)8-6-9-19(2)16-23(26)25-17-21-12-13-21/h6,8-9,11,14,16,21H,7,10,12-13,15,17H2,1-5H3,(H,25,26)/b9-6+,14-11+,18-8+,19-16+ |
| InChIKey | LTDBJOBIIFQIPK-QOUPNPLKSA-N |
| XLogP | 6.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|