C16H19BO5 — CID 56680131
(1S,2R,6R,8R)-11-(4-ethenylphenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane (PubChem CID 56680131) has the molecular formula C16H19BO5 and a molecular weight of 302.14 g/mol. Its IUPAC name is (1S,2R,6R,8R)-11-(4-ethenylphenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R)-11-(4-ethenylphenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 56680131 |
| Molecular Formula | C16H19BO5 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1S,2R,6R,8R)-11-(4-ethenylphenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane |
| SMILES | C=Cc1ccc(B2OC[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]3O2)cc1 |
| InChI | InChI=1S/C16H19BO5/c1-4-10-5-7-11(8-6-10)17-18-9-12-13(22-17)14-15(19-12)21-16(2,3)20-14/h4-8,12-15H,1,9H2,2-3H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | BAMVBLMDZJIJLV-LXTVHRRPSA-N |
| XLogP | 1.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|