C23H20ClN5O2 — CID 56680199
4-[[5-[[[1-(4-chlorobenzoyl)-2-oxopyrrolidin-3-yl]amino]methyl]imidazol-1-yl]methyl]benzonitrile (PubChem CID 56680199) has the molecular formula C23H20ClN5O2 and a molecular weight of 433.90 g/mol. Its IUPAC name is 4-[[5-[[[1-(4-chlorobenzoyl)-2-oxopyrrolidin-3-yl]amino]methyl]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-[[[1-(4-chlorobenzoyl)-2-oxopyrrolidin-3-yl]amino]methyl]imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 56680199 |
| Molecular Formula | C23H20ClN5O2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4-[[5-[[[1-(4-chlorobenzoyl)-2-oxopyrrolidin-3-yl]amino]methyl]imidazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2cncc2CNC2CCN(C(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H20ClN5O2/c24-19-7-5-18(6-8-19)22(30)29-10-9-21(23(29)31)27-13-20-12-26-15-28(20)14-17-3-1-16(11-25)2-4-17/h1-8,12,15,21,27H,9-10,13-14H2 |
| InChIKey | VKCDPCCERFVJMZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|