C17H16N2O5 — CID 56680261
ethyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate (PubChem CID 56680261) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is ethyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate.
| Compound Name | ethyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate |
|---|---|
| PubChem CID | 56680261 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | ethyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1Oc1nc[nH]c(=O)c1/C=C/C(C)=O |
| InChI | InChI=1S/C17H16N2O5/c1-3-23-17(22)12-6-4-5-7-14(12)24-16-13(9-8-11(2)20)15(21)18-10-19-16/h4-10H,3H2,1-2H3,(H,18,19,21)/b9-8+ |
| InChIKey | SKIYONJRQKGOFW-CMDGGOBGSA-N |
| XLogP | 2.34 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|